C23H37N5O2 — CID 123889956
N,N-dimethyl-4-[[4-[2-(2-piperidin-1-ylethylamino)acetyl]phenyl]methyl]piperazine-1-carboxamide (PubChem CID 123889956) has the molecular formula C23H37N5O2 and a molecular weight of 415.58 g/mol. Its IUPAC name is N,N-dimethyl-4-[[4-[2-(2-piperidin-1-ylethylamino)acetyl]phenyl]methyl]piperazine-1-carboxamide.
| Compound Name | N,N-dimethyl-4-[[4-[2-(2-piperidin-1-ylethylamino)acetyl]phenyl]methyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 123889956 |
| Molecular Formula | C23H37N5O2 |
| Molecular Weight | 415.58 g/mol |
| Exact Mass | 415.29 |
| IUPAC Name | N,N-dimethyl-4-[[4-[2-(2-piperidin-1-ylethylamino)acetyl]phenyl]methyl]piperazine-1-carboxamide |
| SMILES | CN(C)C(=O)N1CCN(Cc2ccc(C(=O)CNCCN3CCCCC3)cc2)CC1 |
| InChI | InChI=1S/C23H37N5O2/c1-25(2)23(30)28-16-14-27(15-17-28)19-20-6-8-21(9-7-20)22(29)18-24-10-13-26-11-4-3-5-12-26/h6-9,24H,3-5,10-19H2,1-2H3 |
| InChIKey | RUUJYTKNLRAJNR-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 59.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.58 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|