C12H12N2 — CID 123890112
6-ethynyl-8-methyl-8,9-dihydropyrazino[1,2-a]azepine (PubChem CID 123890112) has the molecular formula C12H12N2 and a molecular weight of 184.24 g/mol. Its IUPAC name is 6-ethynyl-8-methyl-8,9-dihydropyrazino[1,2-a]azepine.
| Compound Name | 6-ethynyl-8-methyl-8,9-dihydropyrazino[1,2-a]azepine |
|---|---|
| PubChem CID | 123890112 |
| Molecular Formula | C12H12N2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | 6-ethynyl-8-methyl-8,9-dihydropyrazino[1,2-a]azepine |
| SMILES | C#CC1=CC(C)CC=C2C=NC=CN12 |
| InChI | InChI=1S/C12H12N2/c1-3-11-8-10(2)4-5-12-9-13-6-7-14(11)12/h1,5-10H,4H2,2H3 |
| InChIKey | ISQOPFQVXYGQHH-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|