C11H14N2 — CID 123899999
7,8-dimethyl-8,9-dihydropyrazino[1,2-a]azepine (PubChem CID 123899999) has the molecular formula C11H14N2 and a molecular weight of 174.25 g/mol. Its IUPAC name is 7,8-dimethyl-8,9-dihydropyrazino[1,2-a]azepine.
| Compound Name | 7,8-dimethyl-8,9-dihydropyrazino[1,2-a]azepine |
|---|---|
| PubChem CID | 123899999 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | 7,8-dimethyl-8,9-dihydropyrazino[1,2-a]azepine |
| SMILES | CC1=CN2C=CN=CC2=CCC1C |
| InChI | InChI=1S/C11H14N2/c1-9-3-4-11-7-12-5-6-13(11)8-10(9)2/h4-9H,3H2,1-2H3 |
| InChIKey | RAGZFQDPHLOQLZ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |