C22H23F2N3O3 — CID 123890259
7-[[3-fluoro-4-(6-fluoro-7-methylocta-3,5,7-trien-4-yl)oxyphenyl]methoxy]-2,3-dihydro-1H-imidazo[1,2-c]pyrimidin-5-one (PubChem CID 123890259) has the molecular formula C22H23F2N3O3 and a molecular weight of 415.44 g/mol. Its IUPAC name is 7-[[3-fluoro-4-(6-fluoro-7-methylocta-3,5,7-trien-4-yl)oxyphenyl]methoxy]-2,3-dihydro-1H-imidazo[1,2-c]pyrimidin-5-one.
| Compound Name | 7-[[3-fluoro-4-(6-fluoro-7-methylocta-3,5,7-trien-4-yl)oxyphenyl]methoxy]-2,3-dihydro-1H-imidazo[1,2-c]pyrimidin-5-one |
|---|---|
| PubChem CID | 123890259 |
| Molecular Formula | C22H23F2N3O3 |
| Molecular Weight | 415.44 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | 7-[[3-fluoro-4-(6-fluoro-7-methylocta-3,5,7-trien-4-yl)oxyphenyl]methoxy]-2,3-dihydro-1H-imidazo[1,2-c]pyrimidin-5-one |
| SMILES | C=C(C)C(F)=CC(=CCC)Oc1ccc(COc2cc3n(c(=O)n2)CCN3)cc1F |
| InChI | InChI=1S/C22H23F2N3O3/c1-4-5-16(11-17(23)14(2)3)30-19-7-6-15(10-18(19)24)13-29-21-12-20-25-8-9-27(20)22(28)26-21/h5-7,10-12,25H,2,4,8-9,13H2,1,3H3 |
| InChIKey | JRSPRIYPMPNCRO-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.44 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|