C17H18F2N4O4S — CID 130232691
4-[(3,4-difluorophenyl)methoxy]-11-methylsulfonyl-1,5,7,11-tetrazatricyclo[7.4.0.02,7]trideca-2,4-dien-6-one (PubChem CID 130232691) has the molecular formula C17H18F2N4O4S and a molecular weight of 412.42 g/mol. Its IUPAC name is 4-[(3,4-difluorophenyl)methoxy]-11-methylsulfonyl-1,5,7,11-tetrazatricyclo[7.4.0.02,7]trideca-2,4-dien-6-one.
| Compound Name | 4-[(3,4-difluorophenyl)methoxy]-11-methylsulfonyl-1,5,7,11-tetrazatricyclo[7.4.0.02,7]trideca-2,4-dien-6-one |
|---|---|
| PubChem CID | 130232691 |
| Molecular Formula | C17H18F2N4O4S |
| Molecular Weight | 412.42 g/mol |
| Exact Mass | 412.10 |
| IUPAC Name | 4-[(3,4-difluorophenyl)methoxy]-11-methylsulfonyl-1,5,7,11-tetrazatricyclo[7.4.0.02,7]trideca-2,4-dien-6-one |
| SMILES | CS(=O)(=O)N1CCN2c3cc(OCc4ccc(F)c(F)c4)nc(=O)n3CC2C1 |
| InChI | InChI=1S/C17H18F2N4O4S/c1-28(25,26)21-4-5-22-12(8-21)9-23-16(22)7-15(20-17(23)24)27-10-11-2-3-13(18)14(19)6-11/h2-3,6-7,12H,4-5,8-10H2,1H3 |
| InChIKey | RTBQTTZZIOLMCY-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 84.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.42 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |