C20H23F2N5O3 — CID 130227450
4-[(3,4-difluorophenyl)methoxy]-11-[2-(dimethylamino)acetyl]-1,5,7,11-tetrazatricyclo[7.4.0.02,7]trideca-2,4-dien-6-one (PubChem CID 130227450) has the molecular formula C20H23F2N5O3 and a molecular weight of 419.43 g/mol. Its IUPAC name is 4-[(3,4-difluorophenyl)methoxy]-11-[2-(dimethylamino)acetyl]-1,5,7,11-tetrazatricyclo[7.4.0.02,7]trideca-2,4-dien-6-one.
| Compound Name | 4-[(3,4-difluorophenyl)methoxy]-11-[2-(dimethylamino)acetyl]-1,5,7,11-tetrazatricyclo[7.4.0.02,7]trideca-2,4-dien-6-one |
|---|---|
| PubChem CID | 130227450 |
| Molecular Formula | C20H23F2N5O3 |
| Molecular Weight | 419.43 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | 4-[(3,4-difluorophenyl)methoxy]-11-[2-(dimethylamino)acetyl]-1,5,7,11-tetrazatricyclo[7.4.0.02,7]trideca-2,4-dien-6-one |
| SMILES | CN(C)CC(=O)N1CCN2c3cc(OCc4ccc(F)c(F)c4)nc(=O)n3CC2C1 |
| InChI | InChI=1S/C20H23F2N5O3/c1-24(2)11-19(28)25-5-6-26-14(9-25)10-27-18(26)8-17(23-20(27)29)30-12-13-3-4-15(21)16(22)7-13/h3-4,7-8,14H,5-6,9-12H2,1-2H3 |
| InChIKey | YCRDQKBUVCIITE-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 70.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.43 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |