C18H17F5N4O2 — CID 130251408
4-[(3,4-difluorophenyl)methoxy]-11-(2,2,2-trifluoroethyl)-1,5,7,11-tetrazatricyclo[7.4.0.02,7]trideca-2,4-dien-6-one (PubChem CID 130251408) has the molecular formula C18H17F5N4O2 and a molecular weight of 416.35 g/mol. Its IUPAC name is 4-[(3,4-difluorophenyl)methoxy]-11-(2,2,2-trifluoroethyl)-1,5,7,11-tetrazatricyclo[7.4.0.02,7]trideca-2,4-dien-6-one.
| Compound Name | 4-[(3,4-difluorophenyl)methoxy]-11-(2,2,2-trifluoroethyl)-1,5,7,11-tetrazatricyclo[7.4.0.02,7]trideca-2,4-dien-6-one |
|---|---|
| PubChem CID | 130251408 |
| Molecular Formula | C18H17F5N4O2 |
| Molecular Weight | 416.35 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | 4-[(3,4-difluorophenyl)methoxy]-11-(2,2,2-trifluoroethyl)-1,5,7,11-tetrazatricyclo[7.4.0.02,7]trideca-2,4-dien-6-one |
| SMILES | O=c1nc(OCc2ccc(F)c(F)c2)cc2n1CC1CN(CC(F)(F)F)CCN21 |
| InChI | InChI=1S/C18H17F5N4O2/c19-13-2-1-11(5-14(13)20)9-29-15-6-16-26-4-3-25(10-18(21,22)23)7-12(26)8-27(16)17(28)24-15/h1-2,5-6,12H,3-4,7-10H2 |
| InChIKey | RWQXEPCBTIYLNU-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.35 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |