C24H27FN6O5 — CID 140798608
tert-butyl N-[2-[4-[(3-cyano-4-fluorophenyl)methoxy]-6-oxo-1,5,7,11-tetrazatricyclo[7.4.0.02,7]trideca-2,4-dien-11-yl]-2-oxoethyl]carbamate (PubChem CID 140798608) has the molecular formula C24H27FN6O5 and a molecular weight of 498.52 g/mol. Its IUPAC name is tert-butyl N-[2-[4-[(3-cyano-4-fluorophenyl)methoxy]-6-oxo-1,5,7,11-tetrazatricyclo[7.4.0.02,7]trideca-2,4-dien-11-yl]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[4-[(3-cyano-4-fluorophenyl)methoxy]-6-oxo-1,5,7,11-tetrazatricyclo[7.4.0.02,7]trideca-2,4-dien-11-yl]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 140798608 |
| Molecular Formula | C24H27FN6O5 |
| Molecular Weight | 498.52 g/mol |
| Exact Mass | 498.20 |
| IUPAC Name | tert-butyl N-[2-[4-[(3-cyano-4-fluorophenyl)methoxy]-6-oxo-1,5,7,11-tetrazatricyclo[7.4.0.02,7]trideca-2,4-dien-11-yl]-2-oxoethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=O)N1CCN2c3cc(OCc4ccc(F)c(C#N)c4)nc(=O)n3CC2C1 |
| InChI | InChI=1S/C24H27FN6O5/c1-24(2,3)36-23(34)27-11-21(32)29-6-7-30-17(12-29)13-31-20(30)9-19(28-22(31)33)35-14-15-4-5-18(25)16(8-15)10-26/h4-5,8-9,17H,6-7,11-14H2,1-3H3,(H,27,34) |
| InChIKey | IKFIAYVNROWVLW-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 129.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.52 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |