C19H15F3N6 — CID 123890595
8-methyl-3-(2H-tetrazol-5-yl)-7-(2,4,5-trifluorophenyl)-6,7,8,9-tetrahydropyrido[1,2-a]benzimidazole (PubChem CID 123890595) has the molecular formula C19H15F3N6 and a molecular weight of 384.37 g/mol. Its IUPAC name is 8-methyl-3-(2H-tetrazol-5-yl)-7-(2,4,5-trifluorophenyl)-6,7,8,9-tetrahydropyrido[1,2-a]benzimidazole.
| Compound Name | 8-methyl-3-(2H-tetrazol-5-yl)-7-(2,4,5-trifluorophenyl)-6,7,8,9-tetrahydropyrido[1,2-a]benzimidazole |
|---|---|
| PubChem CID | 123890595 |
| Molecular Formula | C19H15F3N6 |
| Molecular Weight | 384.37 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | 8-methyl-3-(2H-tetrazol-5-yl)-7-(2,4,5-trifluorophenyl)-6,7,8,9-tetrahydropyrido[1,2-a]benzimidazole |
| SMILES | CC1Cc2c(nc3cc(-c4nn[nH]n4)ccn23)CC1c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C19H15F3N6/c1-9-4-17-16(7-11(9)12-6-14(21)15(22)8-13(12)20)23-18-5-10(2-3-28(17)18)19-24-26-27-25-19/h2-3,5-6,8-9,11H,4,7H2,1H3,(H,24,25,26,27) |
| InChIKey | LUQPWNNFSQRQGM-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 71.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.37 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|