C31H24ClN5O3S — CID 123891154
N-[3-[3-[8-(chloromethyl)-4-hydroxy-1-methyl-7,8-dihydrothieno[3,2-e]indol-6-yl]-3-oxoprop-1-enyl]-1H-pyrrolo[2,3-b]pyridin-5-yl]-1H-indole-2-carboxamide (PubChem CID 123891154) has the molecular formula C31H24ClN5O3S and a molecular weight of 582.09 g/mol. Its IUPAC name is N-[3-[3-[8-(chloromethyl)-4-hydroxy-1-methyl-7,8-dihydrothieno[3,2-e]indol-6-yl]-3-oxoprop-1-enyl]-1H-pyrrolo[2,3-b]pyridin-5-yl]-1H-indole-2-carboxamide.
| Compound Name | N-[3-[3-[8-(chloromethyl)-4-hydroxy-1-methyl-7,8-dihydrothieno[3,2-e]indol-6-yl]-3-oxoprop-1-enyl]-1H-pyrrolo[2,3-b]pyridin-5-yl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 123891154 |
| Molecular Formula | C31H24ClN5O3S |
| Molecular Weight | 582.09 g/mol |
| Exact Mass | 581.13 |
| IUPAC Name | N-[3-[3-[8-(chloromethyl)-4-hydroxy-1-methyl-7,8-dihydrothieno[3,2-e]indol-6-yl]-3-oxoprop-1-enyl]-1H-pyrrolo[2,3-b]pyridin-5-yl]-1H-indole-2-carboxamide |
| SMILES | Cc1csc2c(O)cc3c(c12)C(CCl)CN3C(=O)C=Cc1c[nH]c2ncc(NC(=O)c3cc4ccccc4[nH]3)cc12 |
| InChI | InChI=1S/C31H24ClN5O3S/c1-16-15-41-29-25(38)10-24-28(27(16)29)19(11-32)14-37(24)26(39)7-6-18-12-33-30-21(18)9-20(13-34-30)35-31(40)23-8-17-4-2-3-5-22(17)36-23/h2-10,12-13,15,19,36,38H,11,14H2,1H3,(H,33,34)(H,35,40) |
| InChIKey | DKHKILMWOTZNRZ-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 114.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.09 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|