C31H26ClN5O3 — CID 46240717
4-amino-N-[2-[(E)-3-[(1S)-1-(chloromethyl)-5-hydroxy-9-methyl-1,2-dihydrobenzo[e]indol-3-yl]-3-oxoprop-1-enyl]-1H-pyrrolo[2,3-b]pyridin-5-yl]benzamide (PubChem CID 46240717) has the molecular formula C31H26ClN5O3 and a molecular weight of 552.03 g/mol. Its IUPAC name is 4-amino-N-[2-[(E)-3-[(1S)-1-(chloromethyl)-5-hydroxy-9-methyl-1,2-dihydrobenzo[e]indol-3-yl]-3-oxoprop-1-enyl]-1H-pyrrolo[2,3-b]pyridin-5-yl]benzamide.
| Compound Name | 4-amino-N-[2-[(E)-3-[(1S)-1-(chloromethyl)-5-hydroxy-9-methyl-1,2-dihydrobenzo[e]indol-3-yl]-3-oxoprop-1-enyl]-1H-pyrrolo[2,3-b]pyridin-5-yl]benzamide |
|---|---|
| PubChem CID | 46240717 |
| Molecular Formula | C31H26ClN5O3 |
| Molecular Weight | 552.03 g/mol |
| Exact Mass | 551.17 |
| IUPAC Name | 4-amino-N-[2-[(E)-3-[(1S)-1-(chloromethyl)-5-hydroxy-9-methyl-1,2-dihydrobenzo[e]indol-3-yl]-3-oxoprop-1-enyl]-1H-pyrrolo[2,3-b]pyridin-5-yl]benzamide |
| SMILES | Cc1cccc2c(O)cc3c(c12)[C@H](CCl)CN3C(=O)/C=C/c1cc2cc(NC(=O)c3ccc(N)cc3)cnc2[nH]1 |
| InChI | InChI=1S/C31H26ClN5O3/c1-17-3-2-4-24-26(38)13-25-29(28(17)24)20(14-32)16-37(25)27(39)10-9-22-11-19-12-23(15-34-30(19)35-22)36-31(40)18-5-7-21(33)8-6-18/h2-13,15,20,38H,14,16,33H2,1H3,(H,34,35)(H,36,40)/b10-9+/t20-/m1/s1 |
| InChIKey | WETFDCPIHCADOX-SQUSKLHYSA-N |
| XLogP | 5.95 |
| TPSA | 124.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.03 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|