C29H23ClN4O3S — CID 75183298
4-amino-N-[6-[1-(chloromethyl)-5-hydroxy-9-methyl-1,2-dihydrobenzo[e]indole-3-carbonyl]-1,3-benzothiazol-2-yl]benzamide (PubChem CID 75183298) has the molecular formula C29H23ClN4O3S and a molecular weight of 543.05 g/mol. Its IUPAC name is 4-amino-N-[6-[1-(chloromethyl)-5-hydroxy-9-methyl-1,2-dihydrobenzo[e]indole-3-carbonyl]-1,3-benzothiazol-2-yl]benzamide.
| Compound Name | 4-amino-N-[6-[1-(chloromethyl)-5-hydroxy-9-methyl-1,2-dihydrobenzo[e]indole-3-carbonyl]-1,3-benzothiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 75183298 |
| Molecular Formula | C29H23ClN4O3S |
| Molecular Weight | 543.05 g/mol |
| Exact Mass | 542.12 |
| IUPAC Name | 4-amino-N-[6-[1-(chloromethyl)-5-hydroxy-9-methyl-1,2-dihydrobenzo[e]indole-3-carbonyl]-1,3-benzothiazol-2-yl]benzamide |
| SMILES | Cc1cccc2c(O)cc3c(c12)C(CCl)CN3C(=O)c1ccc2nc(NC(=O)c3ccc(N)cc3)sc2c1 |
| InChI | InChI=1S/C29H23ClN4O3S/c1-15-3-2-4-20-23(35)12-22-26(25(15)20)18(13-30)14-34(22)28(37)17-7-10-21-24(11-17)38-29(32-21)33-27(36)16-5-8-19(31)9-6-16/h2-12,18,35H,13-14,31H2,1H3,(H,32,33,36) |
| InChIKey | RBNAJVYFIJUHSF-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 108.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.05 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|