C28H23ClN4O2 — CID 58408835
[2-(3-aminophenyl)-3H-benzimidazol-5-yl]-[(1S)-1-(chloromethyl)-5-hydroxy-9-methyl-1,2-dihydrobenzo[e]indol-3-yl]methanone (PubChem CID 58408835) has the molecular formula C28H23ClN4O2 and a molecular weight of 482.97 g/mol. Its IUPAC name is [2-(3-aminophenyl)-3H-benzimidazol-5-yl]-[(1S)-1-(chloromethyl)-5-hydroxy-9-methyl-1,2-dihydrobenzo[e]indol-3-yl]methanone.
| Compound Name | [2-(3-aminophenyl)-3H-benzimidazol-5-yl]-[(1S)-1-(chloromethyl)-5-hydroxy-9-methyl-1,2-dihydrobenzo[e]indol-3-yl]methanone |
|---|---|
| PubChem CID | 58408835 |
| Molecular Formula | C28H23ClN4O2 |
| Molecular Weight | 482.97 g/mol |
| Exact Mass | 482.15 |
| IUPAC Name | [2-(3-aminophenyl)-3H-benzimidazol-5-yl]-[(1S)-1-(chloromethyl)-5-hydroxy-9-methyl-1,2-dihydrobenzo[e]indol-3-yl]methanone |
| SMILES | Cc1cccc2c(O)cc3c(c12)[C@H](CCl)CN3C(=O)c1ccc2nc(-c3cccc(N)c3)[nH]c2c1 |
| InChI | InChI=1S/C28H23ClN4O2/c1-15-4-2-7-20-24(34)12-23-26(25(15)20)18(13-29)14-33(23)28(35)17-8-9-21-22(11-17)32-27(31-21)16-5-3-6-19(30)10-16/h2-12,18,34H,13-14,30H2,1H3,(H,31,32)/t18-/m1/s1 |
| InChIKey | VQSWFKKNTIZCQI-GOSISDBHSA-N |
| XLogP | 5.96 |
| TPSA | 95.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.97 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|