C11H12Cl2N2 — CID 123892417
4,7-dichloro-6-ethyl-2-methyl-1,5-dihydropyrrolo[2,3-b]azepine (PubChem CID 123892417) has the molecular formula C11H12Cl2N2 and a molecular weight of 243.14 g/mol. Its IUPAC name is 4,7-dichloro-6-ethyl-2-methyl-1,5-dihydropyrrolo[2,3-b]azepine.
| Compound Name | 4,7-dichloro-6-ethyl-2-methyl-1,5-dihydropyrrolo[2,3-b]azepine |
|---|---|
| PubChem CID | 123892417 |
| Molecular Formula | C11H12Cl2N2 |
| Molecular Weight | 243.14 g/mol |
| Exact Mass | 242.04 |
| IUPAC Name | 4,7-dichloro-6-ethyl-2-methyl-1,5-dihydropyrrolo[2,3-b]azepine |
| SMILES | CCC1=C(Cl)N=c2[nH]c(C)cc2=C(Cl)C1 |
| InChI | InChI=1S/C11H12Cl2N2/c1-3-7-5-9(12)8-4-6(2)14-11(8)15-10(7)13/h4H,3,5H2,1-2H3,(H,14,15) |
| InChIKey | JWOMGQDSKVMYRA-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 28.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.14 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|