C23H15F3N4O — CID 123892899
2-[2-(3,4-diiminocyclohexa-1,5-dien-1-yl)ethenyl]-3-[3-(trifluoromethyl)phenyl]quinazolin-4-one (PubChem CID 123892899) has the molecular formula C23H15F3N4O and a molecular weight of 420.39 g/mol. Its IUPAC name is 2-[2-(3,4-diiminocyclohexa-1,5-dien-1-yl)ethenyl]-3-[3-(trifluoromethyl)phenyl]quinazolin-4-one.
| Compound Name | 2-[2-(3,4-diiminocyclohexa-1,5-dien-1-yl)ethenyl]-3-[3-(trifluoromethyl)phenyl]quinazolin-4-one |
|---|---|
| PubChem CID | 123892899 |
| Molecular Formula | C23H15F3N4O |
| Molecular Weight | 420.39 g/mol |
| Exact Mass | 420.12 |
| IUPAC Name | 2-[2-(3,4-diiminocyclohexa-1,5-dien-1-yl)ethenyl]-3-[3-(trifluoromethyl)phenyl]quinazolin-4-one |
| SMILES | [H]/N=C1/C=C(C=Cc2nc3ccccc3c(=O)n2-c2cccc(C(F)(F)F)c2)C=C/C1=N\[H] |
| InChI | InChI=1S/C23H15F3N4O/c24-23(25,26)15-4-3-5-16(13-15)30-21(11-9-14-8-10-18(27)19(28)12-14)29-20-7-2-1-6-17(20)22(30)31/h1-13,27-28H/b11-9?,27-18+,28-19- |
| InChIKey | WSLKQXBLUOTRSJ-FWUPFERXSA-N |
| XLogP | 4.95 |
| TPSA | 82.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.39 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|