C28H30N6O4 — CID 123893479
11-(1-butan-2-ylpyrazol-4-yl)-3-(4-methoxyphenyl)-4-(3-methyl-1,2-oxazole-4-carbonyl)-1,4,7-triazatricyclo[7.3.0.03,7]dodeca-9,11-dien-8-one (PubChem CID 123893479) has the molecular formula C28H30N6O4 and a molecular weight of 514.59 g/mol. Its IUPAC name is 11-(1-butan-2-ylpyrazol-4-yl)-3-(4-methoxyphenyl)-4-(3-methyl-1,2-oxazole-4-carbonyl)-1,4,7-triazatricyclo[7.3.0.03,7]dodeca-9,11-dien-8-one.
| Compound Name | 11-(1-butan-2-ylpyrazol-4-yl)-3-(4-methoxyphenyl)-4-(3-methyl-1,2-oxazole-4-carbonyl)-1,4,7-triazatricyclo[7.3.0.03,7]dodeca-9,11-dien-8-one |
|---|---|
| PubChem CID | 123893479 |
| Molecular Formula | C28H30N6O4 |
| Molecular Weight | 514.59 g/mol |
| Exact Mass | 514.23 |
| IUPAC Name | 11-(1-butan-2-ylpyrazol-4-yl)-3-(4-methoxyphenyl)-4-(3-methyl-1,2-oxazole-4-carbonyl)-1,4,7-triazatricyclo[7.3.0.03,7]dodeca-9,11-dien-8-one |
| SMILES | CCC(C)n1cc(-c2cc3n(c2)CC2(c4ccc(OC)cc4)N(C(=O)c4conc4C)CCN2C3=O)cn1 |
| InChI | InChI=1S/C28H30N6O4/c1-5-18(2)34-15-21(13-29-34)20-12-25-27(36)33-11-10-32(26(35)24-16-38-30-19(24)3)28(33,17-31(25)14-20)22-6-8-23(37-4)9-7-22/h6-9,12-16,18H,5,10-11,17H2,1-4H3 |
| InChIKey | KQMHOPZRVSCWFU-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 98.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.59 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |