C24H26O4 — CID 123893552
ethane;trans-(1R,2S)-2-ethenyl-1-[2-(9H-fluoren-9-ylmethoxy)-2-oxoethyl]cyclopropane-1-carboxylic acid (PubChem CID 123893552) has the molecular formula C24H26O4 and a molecular weight of 378.47 g/mol. Its IUPAC name is ethane;trans-(1R,2S)-2-ethenyl-1-[2-(9H-fluoren-9-ylmethoxy)-2-oxoethyl]cyclopropane-1-carboxylic acid.
| Compound Name | ethane;trans-(1R,2S)-2-ethenyl-1-[2-(9H-fluoren-9-ylmethoxy)-2-oxoethyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 123893552 |
| Molecular Formula | C24H26O4 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | ethane;trans-(1R,2S)-2-ethenyl-1-[2-(9H-fluoren-9-ylmethoxy)-2-oxoethyl]cyclopropane-1-carboxylic acid |
| SMILES | C=C[C@@H]1C[C@]1(CC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O.CC |
| InChI | InChI=1S/C22H20O4.C2H6/c1-2-14-11-22(14,21(24)25)12-20(23)26-13-19-17-9-5-3-7-15(17)16-8-4-6-10-18(16)19;1-2/h2-10,14,19H,1,11-13H2,(H,24,25);1-2H3/t14-,22-;/m1./s1 |
| InChIKey | HJGSMBCSZSCGAL-LDRWRNAJSA-N |
| XLogP | 5.04 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|