C23H24O4 — CID 161453586
1-[2-(9H-fluoren-9-ylmethoxy)-2-oxoethyl]cyclohexane-1-carboxylic acid (PubChem CID 161453586) has the molecular formula C23H24O4 and a molecular weight of 364.44 g/mol. Its IUPAC name is 1-[2-(9H-fluoren-9-ylmethoxy)-2-oxoethyl]cyclohexane-1-carboxylic acid.
| Compound Name | 1-[2-(9H-fluoren-9-ylmethoxy)-2-oxoethyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 161453586 |
| Molecular Formula | C23H24O4 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | 1-[2-(9H-fluoren-9-ylmethoxy)-2-oxoethyl]cyclohexane-1-carboxylic acid |
| SMILES | O=C(CC1(C(=O)O)CCCCC1)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C23H24O4/c24-21(14-23(22(25)26)12-6-1-7-13-23)27-15-20-18-10-4-2-8-16(18)17-9-3-5-11-19(17)20/h2-5,8-11,20H,1,6-7,12-15H2,(H,25,26) |
| InChIKey | WAVWGFUUMULGSO-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |