C31H38O5 — CID 162244816
2-[1-[10-(9H-fluoren-9-ylmethoxy)-2,10-dioxodecyl]cyclopentyl]acetic acid (PubChem CID 162244816) has the molecular formula C31H38O5 and a molecular weight of 490.64 g/mol. Its IUPAC name is 2-[1-[10-(9H-fluoren-9-ylmethoxy)-2,10-dioxodecyl]cyclopentyl]acetic acid.
| Compound Name | 2-[1-[10-(9H-fluoren-9-ylmethoxy)-2,10-dioxodecyl]cyclopentyl]acetic acid |
|---|---|
| PubChem CID | 162244816 |
| Molecular Formula | C31H38O5 |
| Molecular Weight | 490.64 g/mol |
| Exact Mass | 490.27 |
| IUPAC Name | 2-[1-[10-(9H-fluoren-9-ylmethoxy)-2,10-dioxodecyl]cyclopentyl]acetic acid |
| SMILES | O=C(O)CC1(CC(=O)CCCCCCCC(=O)OCC2c3ccccc3-c3ccccc32)CCCC1 |
| InChI | InChI=1S/C31H38O5/c32-23(20-31(21-29(33)34)18-10-11-19-31)12-4-2-1-3-5-17-30(35)36-22-28-26-15-8-6-13-24(26)25-14-7-9-16-27(25)28/h6-9,13-16,28H,1-5,10-12,17-22H2,(H,33,34) |
| InChIKey | BBWMUVAFZQBNEY-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.64 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|