About 7-O-amino 1-O-(9H-fluoren-9-ylmethyl) heptanedioate
7-O-amino 1-O-(9H-fluoren-9-ylmethyl) heptanedioate (PubChem CID 175239648) has the molecular formula C21H23NO4
and a molecular weight of 353.42 g/mol. Its IUPAC name is 7-O-amino 1-O-(9H-fluoren-9-ylmethyl) heptanedioate.
Molecular Properties
| Compound Name | 7-O-amino 1-O-(9H-fluoren-9-ylmethyl) heptanedioate |
| PubChem CID | 175239648 |
| Molecular Formula | C21H23NO4 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | 7-O-amino 1-O-(9H-fluoren-9-ylmethyl) heptanedioate |
| SMILES | NOC(=O)CCCCCC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C21H23NO4/c22-26-21(24)13-3-1-2-12-20(23)25-14-19-17-10-6-4-8-15(17)16-9-5-7-11-18(16)19/h4-11,19H,1-3,12-14,22H2 |
| InChIKey | YVHZBDBCEXAYFK-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 7-O-amino 1-O-(9H-fluoren-9-ylmethyl) heptanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-O-amino 1-O-(9H-fluoren-9-ylmethyl) heptanedioate?
The IUPAC name of 7-O-amino 1-O-(9H-fluoren-9-ylmethyl) heptanedioate (CID 175239648) is 7-O-amino 1-O-(9H-fluoren-9-ylmethyl) heptanedioate.
What is the SMILES notation for 7-O-amino 1-O-(9H-fluoren-9-ylmethyl) heptanedioate?
The canonical SMILES for 7-O-amino 1-O-(9H-fluoren-9-ylmethyl) heptanedioate is NOC(=O)CCCCCC(=O)OCC1c2ccccc2-c2ccccc21.
What is the InChIKey of 7-O-amino 1-O-(9H-fluoren-9-ylmethyl) heptanedioate?
The InChIKey is YVHZBDBCEXAYFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23NO4/c22-26-21(24)13-3-1-2-12-20(23)25-14-19-17-10-6-4-8-15(17)16-9-5-7-11-18(16)19/h4-11,19H,1-3,12-14,22H2.
What are the key properties of 7-O-amino 1-O-(9H-fluoren-9-ylmethyl) heptanedioate?
7-O-amino 1-O-(9H-fluoren-9-ylmethyl) heptanedioate has a molecular weight of 353.42 g/mol, XLogP of 3.71, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-O-amino 1-O-(9H-fluoren-9-ylmethyl) heptanedioate is sourced from PubChem (CID 175239648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).