C22H37NO2S — CID 123894361
3-(3-aminopropylsulfinyl)-10,13-dimethyl-2,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-ol (PubChem CID 123894361) has the molecular formula C22H37NO2S and a molecular weight of 379.61 g/mol. Its IUPAC name is 3-(3-aminopropylsulfinyl)-10,13-dimethyl-2,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-ol.
| Compound Name | 3-(3-aminopropylsulfinyl)-10,13-dimethyl-2,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-ol |
|---|---|
| PubChem CID | 123894361 |
| Molecular Formula | C22H37NO2S |
| Molecular Weight | 379.61 g/mol |
| Exact Mass | 379.25 |
| IUPAC Name | 3-(3-aminopropylsulfinyl)-10,13-dimethyl-2,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-ol |
| SMILES | CC12CCC3C(CCC4C=C(S(=O)CCCN)CCC43C)C1CCC2O |
| InChI | InChI=1S/C22H37NO2S/c1-21-10-8-16(26(25)13-3-12-23)14-15(21)4-5-17-18-6-7-20(24)22(18,2)11-9-19(17)21/h14-15,17-20,24H,3-13,23H2,1-2H3 |
| InChIKey | DKXRHMLVTVAUME-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.61 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |