C21H31N3O5 — CID 123895018
methyl 2-[[2-acetyloxy-3-(1-aminoethylideneamino)-4-phenylbutanoyl]amino]-4-methylpentanoate (PubChem CID 123895018) has the molecular formula C21H31N3O5 and a molecular weight of 405.50 g/mol. Its IUPAC name is methyl 2-[[2-acetyloxy-3-(1-aminoethylideneamino)-4-phenylbutanoyl]amino]-4-methylpentanoate.
| Compound Name | methyl 2-[[2-acetyloxy-3-(1-aminoethylideneamino)-4-phenylbutanoyl]amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 123895018 |
| Molecular Formula | C21H31N3O5 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.23 |
| IUPAC Name | methyl 2-[[2-acetyloxy-3-(1-aminoethylideneamino)-4-phenylbutanoyl]amino]-4-methylpentanoate |
| SMILES | COC(=O)C(CC(C)C)NC(=O)C(OC(C)=O)C(Cc1ccccc1)/N=C(\C)N |
| InChI | InChI=1S/C21H31N3O5/c1-13(2)11-18(21(27)28-5)24-20(26)19(29-15(4)25)17(23-14(3)22)12-16-9-7-6-8-10-16/h6-10,13,17-19H,11-12H2,1-5H3,(H2,22,23)(H,24,26) |
| InChIKey | RHRIJRFXZVJDQT-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 120.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|