C17H15Cl2N4+ — CID 123895130
4-chloro-5-[(4-chloro-1H-indazol-2-ium-2-yl)methyl]-3-ethyl-2H-indazole (PubChem CID 123895130) has the molecular formula C17H15Cl2N4+ and a molecular weight of 346.24 g/mol. Its IUPAC name is 4-chloro-5-[(4-chloro-1H-indazol-2-ium-2-yl)methyl]-3-ethyl-2H-indazole.
| Compound Name | 4-chloro-5-[(4-chloro-1H-indazol-2-ium-2-yl)methyl]-3-ethyl-2H-indazole |
|---|---|
| PubChem CID | 123895130 |
| Molecular Formula | C17H15Cl2N4+ |
| Molecular Weight | 346.24 g/mol |
| Exact Mass | 345.07 |
| IUPAC Name | 4-chloro-5-[(4-chloro-1H-indazol-2-ium-2-yl)methyl]-3-ethyl-2H-indazole |
| SMILES | CCc1[nH]nc2ccc(C[n+]3cc4c(Cl)cccc4[nH]3)c(Cl)c12 |
| InChI | InChI=1S/C17H14Cl2N4/c1-2-13-16-15(21-20-13)7-6-10(17(16)19)8-23-9-11-12(18)4-3-5-14(11)22-23/h3-7,9H,2,8H2,1H3,(H,20,21)/p+1 |
| InChIKey | ASOQMZQGXWXQKO-UHFFFAOYSA-O |
| XLogP | 4.25 |
| TPSA | 48.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.24 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|