C20H22F3NO — CID 123895339
3-[4-pent-1-ynyl-3-(trifluoromethyl)phenyl]-4,5,6,7,8,8a-hexahydro-3aH-cyclohepta[d][1,2]oxazole (PubChem CID 123895339) has the molecular formula C20H22F3NO and a molecular weight of 349.40 g/mol. Its IUPAC name is 3-[4-pent-1-ynyl-3-(trifluoromethyl)phenyl]-4,5,6,7,8,8a-hexahydro-3aH-cyclohepta[d][1,2]oxazole.
| Compound Name | 3-[4-pent-1-ynyl-3-(trifluoromethyl)phenyl]-4,5,6,7,8,8a-hexahydro-3aH-cyclohepta[d][1,2]oxazole |
|---|---|
| PubChem CID | 123895339 |
| Molecular Formula | C20H22F3NO |
| Molecular Weight | 349.40 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | 3-[4-pent-1-ynyl-3-(trifluoromethyl)phenyl]-4,5,6,7,8,8a-hexahydro-3aH-cyclohepta[d][1,2]oxazole |
| SMILES | CCCC#Cc1ccc(C2=NOC3CCCCCC23)cc1C(F)(F)F |
| InChI | InChI=1S/C20H22F3NO/c1-2-3-5-8-14-11-12-15(13-17(14)20(21,22)23)19-16-9-6-4-7-10-18(16)25-24-19/h11-13,16,18H,2-4,6-7,9-10H2,1H3 |
| InChIKey | VUGZRVNABZALSY-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.40 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|