C11H23N3 — CID 123895418
N-[2-(butylamino)ethyl]-N'-methylbut-2-enimidamide (PubChem CID 123895418) has the molecular formula C11H23N3 and a molecular weight of 197.33 g/mol. Its IUPAC name is N-[2-(butylamino)ethyl]-N'-methylbut-2-enimidamide.
| Compound Name | N-[2-(butylamino)ethyl]-N'-methylbut-2-enimidamide |
|---|---|
| PubChem CID | 123895418 |
| Molecular Formula | C11H23N3 |
| Molecular Weight | 197.33 g/mol |
| Exact Mass | 197.19 |
| IUPAC Name | N-[2-(butylamino)ethyl]-N'-methylbut-2-enimidamide |
| SMILES | CC=C/C(=N\C)NCCNCCCC |
| InChI | InChI=1S/C11H23N3/c1-4-6-8-13-9-10-14-11(12-3)7-5-2/h5,7,13H,4,6,8-10H2,1-3H3,(H,12,14) |
| InChIKey | AKOLYBFPVSRPLR-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.33 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|