C9H16O2 — CID 123897869
1-(3-methylbuta-1,3-dien-2-yloxy)butan-2-ol (PubChem CID 123897869) has the molecular formula C9H16O2 and a molecular weight of 156.22 g/mol. Its IUPAC name is 1-(3-methylbuta-1,3-dien-2-yloxy)butan-2-ol.
| Compound Name | 1-(3-methylbuta-1,3-dien-2-yloxy)butan-2-ol |
|---|---|
| PubChem CID | 123897869 |
| Molecular Formula | C9H16O2 |
| Molecular Weight | 156.22 g/mol |
| Exact Mass | 156.12 |
| IUPAC Name | 1-(3-methylbuta-1,3-dien-2-yloxy)butan-2-ol |
| SMILES | C=C(C)C(=C)OCC(O)CC |
| InChI | InChI=1S/C9H16O2/c1-5-9(10)6-11-8(4)7(2)3/h9-10H,2,4-6H2,1,3H3 |
| InChIKey | MEWBCYXPMHNESV-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.22 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|