C21H28BN3O3S2 — CID 123898241
4-(2,4-dimethyl-1,3-thiazol-5-yl)-N-[5-di(propan-2-yloxy)boranyl-2-methoxyphenyl]-1,3-thiazol-2-amine (PubChem CID 123898241) has the molecular formula C21H28BN3O3S2 and a molecular weight of 445.42 g/mol. Its IUPAC name is 4-(2,4-dimethyl-1,3-thiazol-5-yl)-N-[5-di(propan-2-yloxy)boranyl-2-methoxyphenyl]-1,3-thiazol-2-amine.
| Compound Name | 4-(2,4-dimethyl-1,3-thiazol-5-yl)-N-[5-di(propan-2-yloxy)boranyl-2-methoxyphenyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 123898241 |
| Molecular Formula | C21H28BN3O3S2 |
| Molecular Weight | 445.42 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | 4-(2,4-dimethyl-1,3-thiazol-5-yl)-N-[5-di(propan-2-yloxy)boranyl-2-methoxyphenyl]-1,3-thiazol-2-amine |
| SMILES | COc1ccc(B(OC(C)C)OC(C)C)cc1Nc1nc(-c2sc(C)nc2C)cs1 |
| InChI | InChI=1S/C21H28BN3O3S2/c1-12(2)27-22(28-13(3)4)16-8-9-19(26-7)17(10-16)24-21-25-18(11-29-21)20-14(5)23-15(6)30-20/h8-13H,1-7H3,(H,24,25) |
| InChIKey | OAKBKPIIEIRKMN-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 65.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.42 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|