About 7-[(5-cyclohexyl-1,2,4-oxadiazol-3-yl)methylamino]-7-methylbicyclo[3.3.1]nonan-3-ol
7-[(5-cyclohexyl-1,2,4-oxadiazol-3-yl)methylamino]-7-methylbicyclo[3.3.1]nonan-3-ol (PubChem CID 123898412) has the molecular formula C19H31N3O2
and a molecular weight of 333.48 g/mol. Its IUPAC name is 7-[(5-cyclohexyl-1,2,4-oxadiazol-3-yl)methylamino]-7-methylbicyclo[3.3.1]nonan-3-ol.
Molecular Properties
| Compound Name | 7-[(5-cyclohexyl-1,2,4-oxadiazol-3-yl)methylamino]-7-methylbicyclo[3.3.1]nonan-3-ol |
| PubChem CID | 123898412 |
| Molecular Formula | C19H31N3O2 |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.24 |
| IUPAC Name | 7-[(5-cyclohexyl-1,2,4-oxadiazol-3-yl)methylamino]-7-methylbicyclo[3.3.1]nonan-3-ol |
| SMILES | CC1(NCc2noc(C3CCCCC3)n2)CC2CC(O)CC(C2)C1 |
| InChI | InChI=1S/C19H31N3O2/c1-19(10-13-7-14(11-19)9-16(23)8-13)20-12-17-21-18(24-22-17)15-5-3-2-4-6-15/h13-16,20,23H,2-12H2,1H3 |
| InChIKey | MNCMKTZCXDPPMC-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 71.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 7-[(5-cyclohexyl-1,2,4-oxadiazol-3-yl)methylamino]-7-methylbicyclo[3.3.1]nonan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[(5-cyclohexyl-1,2,4-oxadiazol-3-yl)methylamino]-7-methylbicyclo[3.3.1]nonan-3-ol?
The IUPAC name of 7-[(5-cyclohexyl-1,2,4-oxadiazol-3-yl)methylamino]-7-methylbicyclo[3.3.1]nonan-3-ol (CID 123898412) is 7-[(5-cyclohexyl-1,2,4-oxadiazol-3-yl)methylamino]-7-methylbicyclo[3.3.1]nonan-3-ol.
What is the SMILES notation for 7-[(5-cyclohexyl-1,2,4-oxadiazol-3-yl)methylamino]-7-methylbicyclo[3.3.1]nonan-3-ol?
The canonical SMILES for 7-[(5-cyclohexyl-1,2,4-oxadiazol-3-yl)methylamino]-7-methylbicyclo[3.3.1]nonan-3-ol is CC1(NCc2noc(C3CCCCC3)n2)CC2CC(O)CC(C2)C1.
What is the InChIKey of 7-[(5-cyclohexyl-1,2,4-oxadiazol-3-yl)methylamino]-7-methylbicyclo[3.3.1]nonan-3-ol?
The InChIKey is MNCMKTZCXDPPMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H31N3O2/c1-19(10-13-7-14(11-19)9-16(23)8-13)20-12-17-21-18(24-22-17)15-5-3-2-4-6-15/h13-16,20,23H,2-12H2,1H3.
What are the key properties of 7-[(5-cyclohexyl-1,2,4-oxadiazol-3-yl)methylamino]-7-methylbicyclo[3.3.1]nonan-3-ol?
7-[(5-cyclohexyl-1,2,4-oxadiazol-3-yl)methylamino]-7-methylbicyclo[3.3.1]nonan-3-ol has a molecular weight of 333.48 g/mol, XLogP of 3.54, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[(5-cyclohexyl-1,2,4-oxadiazol-3-yl)methylamino]-7-methylbicyclo[3.3.1]nonan-3-ol is sourced from PubChem (CID 123898412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).