About (E)-3-diazenylbut-2-enal
(E)-3-diazenylbut-2-enal (PubChem CID 123898632) has the molecular formula C4H6N2O
and a molecular weight of 98.10 g/mol. Its IUPAC name is (E)-3-diazenylbut-2-enal.
Molecular Properties
| Compound Name | (E)-3-diazenylbut-2-enal |
| PubChem CID | 123898632 |
| Molecular Formula | C4H6N2O |
| Molecular Weight | 98.10 g/mol |
| Exact Mass | 98.05 |
| IUPAC Name | (E)-3-diazenylbut-2-enal |
| SMILES | [H]/N=N/C(C)=C/C=O |
| InChI | InChI=1S/C4H6N2O/c1-4(6-5)2-3-7/h2-3,5H,1H3/b4-2+,6-5+ |
| InChIKey | WMQVJLKFSNPOFV-WCOVXTEMSA-N |
| XLogP | 1.12 |
| TPSA | 53.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 98.10 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-diazenylbut-2-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-diazenylbut-2-enal?
The IUPAC name of (E)-3-diazenylbut-2-enal (CID 123898632) is (E)-3-diazenylbut-2-enal.
What is the SMILES notation for (E)-3-diazenylbut-2-enal?
The canonical SMILES for (E)-3-diazenylbut-2-enal is [H]/N=N/C(C)=C/C=O.
What is the InChIKey of (E)-3-diazenylbut-2-enal?
The InChIKey is WMQVJLKFSNPOFV-WCOVXTEMSA-N. The full InChI is InChI=1S/C4H6N2O/c1-4(6-5)2-3-7/h2-3,5H,1H3/b4-2+,6-5+.
What are the key properties of (E)-3-diazenylbut-2-enal?
(E)-3-diazenylbut-2-enal has a molecular weight of 98.10 g/mol, XLogP of 1.12, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-diazenylbut-2-enal is sourced from PubChem (CID 123898632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).