About 3-aminobut-2-enal
3-aminobut-2-enal (PubChem CID 54234844) has the molecular formula C4H7NO
and a molecular weight of 85.11 g/mol. Its IUPAC name is 3-aminobut-2-enal.
Molecular Properties
| Compound Name | 3-aminobut-2-enal |
| PubChem CID | 54234844 |
| Molecular Formula | C4H7NO |
| Molecular Weight | 85.11 g/mol |
| Exact Mass | 85.05 |
| IUPAC Name | 3-aminobut-2-enal |
| SMILES | CC(N)=CC=O |
| InChI | InChI=1S/C4H7NO/c1-4(5)2-3-6/h2-3H,5H2,1H3 |
| InChIKey | JLIDPRFIBGNRGS-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 85.11 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-aminobut-2-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-aminobut-2-enal?
The IUPAC name of 3-aminobut-2-enal (CID 54234844) is 3-aminobut-2-enal.
What is the SMILES notation for 3-aminobut-2-enal?
The canonical SMILES for 3-aminobut-2-enal is CC(N)=CC=O.
What is the InChIKey of 3-aminobut-2-enal?
The InChIKey is JLIDPRFIBGNRGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7NO/c1-4(5)2-3-6/h2-3H,5H2,1H3.
What are the key properties of 3-aminobut-2-enal?
3-aminobut-2-enal has a molecular weight of 85.11 g/mol, XLogP of 0.05, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-aminobut-2-enal is sourced from PubChem (CID 54234844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).