C20H28N6 — CID 123899440
10-cyclopenta-1,3-dien-1-yl-3,8-dimethyl-5-(4-methylpiperazin-1-yl)-7,8-dihydro-3H-[1,2,3,5]tetrazino[1,6-a]azocine (PubChem CID 123899440) has the molecular formula C20H28N6 and a molecular weight of 352.49 g/mol. Its IUPAC name is 10-cyclopenta-1,3-dien-1-yl-3,8-dimethyl-5-(4-methylpiperazin-1-yl)-7,8-dihydro-3H-[1,2,3,5]tetrazino[1,6-a]azocine.
| Compound Name | 10-cyclopenta-1,3-dien-1-yl-3,8-dimethyl-5-(4-methylpiperazin-1-yl)-7,8-dihydro-3H-[1,2,3,5]tetrazino[1,6-a]azocine |
|---|---|
| PubChem CID | 123899440 |
| Molecular Formula | C20H28N6 |
| Molecular Weight | 352.49 g/mol |
| Exact Mass | 352.24 |
| IUPAC Name | 10-cyclopenta-1,3-dien-1-yl-3,8-dimethyl-5-(4-methylpiperazin-1-yl)-7,8-dihydro-3H-[1,2,3,5]tetrazino[1,6-a]azocine |
| SMILES | CC1C=C(C2=CC=CC2)N2N=NC(C)N=C2C(N2CCN(C)CC2)=CC1 |
| InChI | InChI=1S/C20H28N6/c1-15-8-9-18(25-12-10-24(3)11-13-25)20-21-16(2)22-23-26(20)19(14-15)17-6-4-5-7-17/h4-6,9,14-16H,7-8,10-13H2,1-3H3 |
| InChIKey | UWGLBRIEEAWNBZ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 46.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.49 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |