C18H28N4 — CID 142085184
(3E)-5-[4-[(4-methylcyclohexa-1,5-dien-1-yl)methyl]piperazin-1-yl]-5-methyliminopenta-1,3-dien-3-amine (PubChem CID 142085184) has the molecular formula C18H28N4 and a molecular weight of 300.45 g/mol. Its IUPAC name is (3E)-5-[4-[(4-methylcyclohexa-1,5-dien-1-yl)methyl]piperazin-1-yl]-5-methyliminopenta-1,3-dien-3-amine.
| Compound Name | (3E)-5-[4-[(4-methylcyclohexa-1,5-dien-1-yl)methyl]piperazin-1-yl]-5-methyliminopenta-1,3-dien-3-amine |
|---|---|
| PubChem CID | 142085184 |
| Molecular Formula | C18H28N4 |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.23 |
| IUPAC Name | (3E)-5-[4-[(4-methylcyclohexa-1,5-dien-1-yl)methyl]piperazin-1-yl]-5-methyliminopenta-1,3-dien-3-amine |
| SMILES | C=C/C(N)=C\C(=N/C)N1CCN(CC2=CCC(C)C=C2)CC1 |
| InChI | InChI=1S/C18H28N4/c1-4-17(19)13-18(20-3)22-11-9-21(10-12-22)14-16-7-5-15(2)6-8-16/h4-5,7-8,13,15H,1,6,9-12,14,19H2,2-3H3/b17-13+,20-18+ |
| InChIKey | BOZPFXXZPKVWTN-ITVGRBOHSA-N |
| XLogP | 2.18 |
| TPSA | 44.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|