C17H27N7 — CID 123385845
N'-[C-[(E)-2-(3,4-dihydropyridin-6-yl)ethenyl]-N-methylcarbonimidoyl]-3-imino-3-(4-methylpiperazin-1-yl)propanimidamide (PubChem CID 123385845) has the molecular formula C17H27N7 and a molecular weight of 329.45 g/mol. Its IUPAC name is N'-[C-[(E)-2-(3,4-dihydropyridin-6-yl)ethenyl]-N-methylcarbonimidoyl]-3-imino-3-(4-methylpiperazin-1-yl)propanimidamide.
| Compound Name | N'-[C-[(E)-2-(3,4-dihydropyridin-6-yl)ethenyl]-N-methylcarbonimidoyl]-3-imino-3-(4-methylpiperazin-1-yl)propanimidamide |
|---|---|
| PubChem CID | 123385845 |
| Molecular Formula | C17H27N7 |
| Molecular Weight | 329.45 g/mol |
| Exact Mass | 329.23 |
| IUPAC Name | N'-[C-[(E)-2-(3,4-dihydropyridin-6-yl)ethenyl]-N-methylcarbonimidoyl]-3-imino-3-(4-methylpiperazin-1-yl)propanimidamide |
| SMILES | [H]/N=C(\C/C(N)=N/C(/C=C/C1=CCCC=N1)=N/C)N1CCN(C)CC1 |
| InChI | InChI=1S/C17H27N7/c1-20-17(7-6-14-5-3-4-8-21-14)22-15(18)13-16(19)24-11-9-23(2)10-12-24/h5-8,19H,3-4,9-13H2,1-2H3,(H2,18,20,22)/b7-6+,19-16+ |
| InChIKey | KQZYWAAMYAQIPW-OXZWPIFVSA-N |
| XLogP | 1.29 |
| TPSA | 93.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.45 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|