C18H32N6 — CID 143397540
3-[[(6E)-6-[(Z)-but-2-enylidene]-2-(piperazin-1-ylmethyl)-1H-pyrimidin-4-ylidene]amino]-N,N-dimethylpropan-1-amine (PubChem CID 143397540) has the molecular formula C18H32N6 and a molecular weight of 332.50 g/mol. Its IUPAC name is 3-[[(6E)-6-[(Z)-but-2-enylidene]-2-(piperazin-1-ylmethyl)-1H-pyrimidin-4-ylidene]amino]-N,N-dimethylpropan-1-amine.
| Compound Name | 3-[[(6E)-6-[(Z)-but-2-enylidene]-2-(piperazin-1-ylmethyl)-1H-pyrimidin-4-ylidene]amino]-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 143397540 |
| Molecular Formula | C18H32N6 |
| Molecular Weight | 332.50 g/mol |
| Exact Mass | 332.27 |
| IUPAC Name | 3-[[(6E)-6-[(Z)-but-2-enylidene]-2-(piperazin-1-ylmethyl)-1H-pyrimidin-4-ylidene]amino]-N,N-dimethylpropan-1-amine |
| SMILES | C/C=C\C=C1/C/C(=N\CCCN(C)C)N=C(CN2CCNCC2)N1 |
| InChI | InChI=1S/C18H32N6/c1-4-5-7-16-14-17(20-8-6-11-23(2)3)22-18(21-16)15-24-12-9-19-10-13-24/h4-5,7,19H,6,8-15H2,1-3H3,(H,20,21,22)/b5-4-,16-7+ |
| InChIKey | KJVJPPLCHLCKSI-NXJGATQJSA-N |
| XLogP | 1.09 |
| TPSA | 55.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.50 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|