C20H42N4 — CID 144572100
ethane;1-methyl-4-[(3E,5Z)-5-methylocta-3,5-dien-3-yl]piperazine;N'-methylpropanimidamide (PubChem CID 144572100) has the molecular formula C20H42N4 and a molecular weight of 338.58 g/mol. Its IUPAC name is ethane;1-methyl-4-[(3E,5Z)-5-methylocta-3,5-dien-3-yl]piperazine;N'-methylpropanimidamide.
| Compound Name | ethane;1-methyl-4-[(3E,5Z)-5-methylocta-3,5-dien-3-yl]piperazine;N'-methylpropanimidamide |
|---|---|
| PubChem CID | 144572100 |
| Molecular Formula | C20H42N4 |
| Molecular Weight | 338.58 g/mol |
| Exact Mass | 338.34 |
| IUPAC Name | ethane;1-methyl-4-[(3E,5Z)-5-methylocta-3,5-dien-3-yl]piperazine;N'-methylpropanimidamide |
| SMILES | CC.CC/C(N)=N\C.CC/C=C(C)\C=C(/CC)N1CCN(C)CC1 |
| InChI | InChI=1S/C14H26N2.C4H10N2.C2H6/c1-5-7-13(3)12-14(6-2)16-10-8-15(4)9-11-16;1-3-4(5)6-2;1-2/h7,12H,5-6,8-11H2,1-4H3;3H2,1-2H3,(H2,5,6);1-2H3/b13-7-,14-12+;; |
| InChIKey | INAUUXVXICXDJW-ZGBLZHRRSA-N |
| XLogP | 4.29 |
| TPSA | 44.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.58 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|