C14H17N5 — CID 59012881
N'-[2-[4-(diisocyanomethylidene)-2,6-dimethyl-1-pyridinyl]ethyl]ethanimidamide (PubChem CID 59012881) has the molecular formula C14H17N5 and a molecular weight of 255.32 g/mol. Its IUPAC name is N'-[2-[4-(diisocyanomethylidene)-2,6-dimethyl-1-pyridinyl]ethyl]ethanimidamide.
| Compound Name | N'-[2-[4-(diisocyanomethylidene)-2,6-dimethyl-1-pyridinyl]ethyl]ethanimidamide |
|---|---|
| PubChem CID | 59012881 |
| Molecular Formula | C14H17N5 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | N'-[2-[4-(diisocyanomethylidene)-2,6-dimethyl-1-pyridinyl]ethyl]ethanimidamide |
| SMILES | [C-]#[N+]C([N+]#[C-])=C1C=C(C)N(CC/N=C(\C)N)C(C)=C1 |
| InChI | InChI=1S/C14H17N5/c1-10-8-13(14(16-4)17-5)9-11(2)19(10)7-6-18-12(3)15/h8-9H,6-7H2,1-3H3,(H2,15,18) |
| InChIKey | DXALRLWQIWNPIG-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 50.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|