C13H17N6+ — CID 135992778
diaminomethylidene-[2-[4-(diisocyanomethylidene)-2,6-dimethyl-1-pyridinyl]ethyl]azanium (PubChem CID 135992778) has the molecular formula C13H17N6+ and a molecular weight of 257.32 g/mol. Its IUPAC name is diaminomethylidene-[2-[4-(diisocyanomethylidene)-2,6-dimethyl-1-pyridinyl]ethyl]azanium.
| Compound Name | diaminomethylidene-[2-[4-(diisocyanomethylidene)-2,6-dimethyl-1-pyridinyl]ethyl]azanium |
|---|---|
| PubChem CID | 135992778 |
| Molecular Formula | C13H17N6+ |
| Molecular Weight | 257.32 g/mol |
| Exact Mass | 257.15 |
| IUPAC Name | diaminomethylidene-[2-[4-(diisocyanomethylidene)-2,6-dimethyl-1-pyridinyl]ethyl]azanium |
| SMILES | [C-]#[N+]C([N+]#[C-])=C1C=C(C)N(CC[NH+]=C(N)N)C(C)=C1 |
| InChI | InChI=1S/C13H16N6/c1-9-7-11(12(16-3)17-4)8-10(2)19(9)6-5-18-13(14)15/h7-8H,5-6H2,1-2H3,(H4,14,15,18)/p+1 |
| InChIKey | HEDXMUWNUROSQU-UHFFFAOYSA-O |
| XLogP | -0.49 |
| TPSA | 77.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.32 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|