C14H18N6 — CID 163643434
1-[2-[4-(dicyanomethylidene)-2,6-dimethyl-1-pyridinyl]ethyl]-2-methylguanidine (PubChem CID 163643434) has the molecular formula C14H18N6 and a molecular weight of 270.34 g/mol. Its IUPAC name is 1-[2-[4-(dicyanomethylidene)-2,6-dimethyl-1-pyridinyl]ethyl]-2-methylguanidine.
| Compound Name | 1-[2-[4-(dicyanomethylidene)-2,6-dimethyl-1-pyridinyl]ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 163643434 |
| Molecular Formula | C14H18N6 |
| Molecular Weight | 270.34 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | 1-[2-[4-(dicyanomethylidene)-2,6-dimethyl-1-pyridinyl]ethyl]-2-methylguanidine |
| SMILES | C/N=C(\N)NCCN1C(C)=CC(=C(C#N)C#N)C=C1C |
| InChI | InChI=1S/C14H18N6/c1-10-6-12(13(8-15)9-16)7-11(2)20(10)5-4-19-14(17)18-3/h6-7H,4-5H2,1-3H3,(H3,17,18,19) |
| InChIKey | IGGAAAYBOSLQOS-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 101.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.34 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|