C12H14N5+ — CID 137061460
[1-amino-2-[4-(diisocyanomethylidene)-2,6-dimethyl-1-pyridinyl]ethylidene]azanium (PubChem CID 137061460) has the molecular formula C12H14N5+ and a molecular weight of 228.28 g/mol. Its IUPAC name is [1-amino-2-[4-(diisocyanomethylidene)-2,6-dimethyl-1-pyridinyl]ethylidene]azanium.
| Compound Name | [1-amino-2-[4-(diisocyanomethylidene)-2,6-dimethyl-1-pyridinyl]ethylidene]azanium |
|---|---|
| PubChem CID | 137061460 |
| Molecular Formula | C12H14N5+ |
| Molecular Weight | 228.28 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | [1-amino-2-[4-(diisocyanomethylidene)-2,6-dimethyl-1-pyridinyl]ethylidene]azanium |
| SMILES | [C-]#[N+]C([N+]#[C-])=C1C=C(C)N(CC(N)=[NH2+])C(C)=C1 |
| InChI | InChI=1S/C12H13N5/c1-8-5-10(12(15-3)16-4)6-9(2)17(8)7-11(13)14/h5-6H,7H2,1-2H3,(H3,13,14)/p+1 |
| InChIKey | LOFZYBYUMNJBLS-UHFFFAOYSA-O |
| XLogP | 0.28 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.28 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|