C9H15N3 — CID 142175159
N,N,4-trimethyl-1,2-dihydropyridine-6-carboximidamide (PubChem CID 142175159) has the molecular formula C9H15N3 and a molecular weight of 165.24 g/mol. Its IUPAC name is N,N,4-trimethyl-1,2-dihydropyridine-6-carboximidamide.
| Compound Name | N,N,4-trimethyl-1,2-dihydropyridine-6-carboximidamide |
|---|---|
| PubChem CID | 142175159 |
| Molecular Formula | C9H15N3 |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.13 |
| IUPAC Name | N,N,4-trimethyl-1,2-dihydropyridine-6-carboximidamide |
| SMILES | [H]/N=C(/C1=CC(C)=CCN1)N(C)C |
| InChI | InChI=1S/C9H15N3/c1-7-4-5-11-8(6-7)9(10)12(2)3/h4,6,10-11H,5H2,1-3H3/b10-9- |
| InChIKey | UAZBKTXHJNEJRS-KTKRTIGZSA-N |
| XLogP | 0.96 |
| TPSA | 39.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|