C12H19N3 — CID 144559578
(2Z)-2-(6-ethyl-4-methyl-1H-pyridin-2-ylidene)-N,N-dimethylethanimidamide (PubChem CID 144559578) has the molecular formula C12H19N3 and a molecular weight of 205.30 g/mol. Its IUPAC name is (2Z)-2-(6-ethyl-4-methyl-1H-pyridin-2-ylidene)-N,N-dimethylethanimidamide.
| Compound Name | (2Z)-2-(6-ethyl-4-methyl-1H-pyridin-2-ylidene)-N,N-dimethylethanimidamide |
|---|---|
| PubChem CID | 144559578 |
| Molecular Formula | C12H19N3 |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | (2Z)-2-(6-ethyl-4-methyl-1H-pyridin-2-ylidene)-N,N-dimethylethanimidamide |
| SMILES | [H]/N=C(/C=C1/C=C(C)C=C(CC)N1)N(C)C |
| InChI | InChI=1S/C12H19N3/c1-5-10-6-9(2)7-11(14-10)8-12(13)15(3)4/h6-8,13-14H,5H2,1-4H3/b11-8-,13-12- |
| InChIKey | CCBXNNLOQVCFKV-PMESKEJUSA-N |
| XLogP | 2.25 |
| TPSA | 39.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|