C12H19N3 — CID 144559472
(2Z)-N'-ethyl-2-(6-ethyl-4-methyl-1H-pyridin-2-ylidene)ethanimidamide (PubChem CID 144559472) has the molecular formula C12H19N3 and a molecular weight of 205.30 g/mol. Its IUPAC name is (2Z)-N'-ethyl-2-(6-ethyl-4-methyl-1H-pyridin-2-ylidene)ethanimidamide.
| Compound Name | (2Z)-N'-ethyl-2-(6-ethyl-4-methyl-1H-pyridin-2-ylidene)ethanimidamide |
|---|---|
| PubChem CID | 144559472 |
| Molecular Formula | C12H19N3 |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | (2Z)-N'-ethyl-2-(6-ethyl-4-methyl-1H-pyridin-2-ylidene)ethanimidamide |
| SMILES | CC/N=C(N)/C=C1/C=C(C)C=C(CC)N1 |
| InChI | InChI=1S/C12H19N3/c1-4-10-6-9(3)7-11(15-10)8-12(13)14-5-2/h6-8,15H,4-5H2,1-3H3,(H2,13,14)/b11-8- |
| InChIKey | LNZMTZXSULYFED-FLIBITNWSA-N |
| XLogP | 2.09 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|