C9H17N3 — CID 144787200
(2Z)-6-methyl-3-(methylamino)hepta-2,5-dienimidamide (PubChem CID 144787200) has the molecular formula C9H17N3 and a molecular weight of 167.26 g/mol. Its IUPAC name is (2Z)-6-methyl-3-(methylamino)hepta-2,5-dienimidamide.
| Compound Name | (2Z)-6-methyl-3-(methylamino)hepta-2,5-dienimidamide |
|---|---|
| PubChem CID | 144787200 |
| Molecular Formula | C9H17N3 |
| Molecular Weight | 167.26 g/mol |
| Exact Mass | 167.14 |
| IUPAC Name | (2Z)-6-methyl-3-(methylamino)hepta-2,5-dienimidamide |
| SMILES | [H]/N=C(N)/C=C(/CC=C(C)C)NC |
| InChI | InChI=1S/C9H17N3/c1-7(2)4-5-8(12-3)6-9(10)11/h4,6,12H,5H2,1-3H3,(H3,10,11)/b8-6- |
| InChIKey | IWAQBLQIVIOLDG-VURMDHGXSA-N |
| XLogP | 1.38 |
| TPSA | 61.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.26 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|