C8H18N3+ — CID 163794336
(3-amino-4,4-dimethylpent-2-enimidoyl)-methylazanium (PubChem CID 163794336) has the molecular formula C8H18N3+ and a molecular weight of 156.25 g/mol. Its IUPAC name is (3-amino-4,4-dimethylpent-2-enimidoyl)-methylazanium.
| Compound Name | (3-amino-4,4-dimethylpent-2-enimidoyl)-methylazanium |
|---|---|
| PubChem CID | 163794336 |
| Molecular Formula | C8H18N3+ |
| Molecular Weight | 156.25 g/mol |
| Exact Mass | 156.15 |
| IUPAC Name | (3-amino-4,4-dimethylpent-2-enimidoyl)-methylazanium |
| SMILES | [H]/N=C(/C=C(N)C(C)(C)C)[NH2+]C |
| InChI | InChI=1S/C8H17N3/c1-8(2,3)6(9)5-7(10)11-4/h5H,9H2,1-4H3,(H2,10,11)/p+1 |
| InChIKey | HYKGORBBZGPGES-UHFFFAOYSA-O |
| XLogP | 0.05 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.25 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|