C8H17N3 — CID 144787213
(Z)-4,4-dimethyl-3-(methylamino)pent-2-enimidamide (PubChem CID 144787213) has the molecular formula C8H17N3 and a molecular weight of 155.24 g/mol. Its IUPAC name is (Z)-4,4-dimethyl-3-(methylamino)pent-2-enimidamide.
| Compound Name | (Z)-4,4-dimethyl-3-(methylamino)pent-2-enimidamide |
|---|---|
| PubChem CID | 144787213 |
| Molecular Formula | C8H17N3 |
| Molecular Weight | 155.24 g/mol |
| Exact Mass | 155.14 |
| IUPAC Name | (Z)-4,4-dimethyl-3-(methylamino)pent-2-enimidamide |
| SMILES | [H]/N=C(N)/C=C(\NC)C(C)(C)C |
| InChI | InChI=1S/C8H17N3/c1-8(2,3)6(11-4)5-7(9)10/h5,11H,1-4H3,(H3,9,10)/b6-5- |
| InChIKey | SLJCCYFTYCAYLZ-WAYWQWQTSA-N |
| XLogP | 1.07 |
| TPSA | 61.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.24 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|