C9H19N3 — CID 89257961
(Z)-3-amino-N,N',4,4-tetramethylpent-2-enimidamide (PubChem CID 89257961) has the molecular formula C9H19N3 and a molecular weight of 169.27 g/mol. Its IUPAC name is (Z)-3-amino-N,N',4,4-tetramethylpent-2-enimidamide.
| Compound Name | (Z)-3-amino-N,N',4,4-tetramethylpent-2-enimidamide |
|---|---|
| PubChem CID | 89257961 |
| Molecular Formula | C9H19N3 |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.16 |
| IUPAC Name | (Z)-3-amino-N,N',4,4-tetramethylpent-2-enimidamide |
| SMILES | C/N=C(/C=C(\N)C(C)(C)C)NC |
| InChI | InChI=1S/C9H19N3/c1-9(2,3)7(10)6-8(11-4)12-5/h6H,10H2,1-5H3,(H,11,12)/b7-6- |
| InChIKey | AHEUJSQUHZSGKF-SREVYHEPSA-N |
| XLogP | 1.12 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|