C11H19N3 — CID 172597543
N'-methyl-N-[(4Z)-2-methyl-5-(methylamino)hexa-1,4-dien-3-ylidene]ethanimidamide (PubChem CID 172597543) has the molecular formula C11H19N3 and a molecular weight of 193.29 g/mol. Its IUPAC name is N'-methyl-N-[(4Z)-2-methyl-5-(methylamino)hexa-1,4-dien-3-ylidene]ethanimidamide.
| Compound Name | N'-methyl-N-[(4Z)-2-methyl-5-(methylamino)hexa-1,4-dien-3-ylidene]ethanimidamide |
|---|---|
| PubChem CID | 172597543 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | N'-methyl-N-[(4Z)-2-methyl-5-(methylamino)hexa-1,4-dien-3-ylidene]ethanimidamide |
| SMILES | C=C(C)C(/C=C(/C)NC)=N\C(C)=N\C |
| InChI | InChI=1S/C11H19N3/c1-8(2)11(7-9(3)12-5)14-10(4)13-6/h7,12H,1H2,2-6H3/b9-7-,13-10+,14-11- |
| InChIKey | JIHMKMZHMNUQMY-DBRNYMEJSA-N |
| XLogP | 2.17 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|