About N-[(Z)-5-amino-2-methylhex-4-en-3-ylidene]-N'-methylethanimidamide;ethane
N-[(Z)-5-amino-2-methylhex-4-en-3-ylidene]-N'-methylethanimidamide;ethane (PubChem CID 172597690) has the molecular formula C16H37N3
and a molecular weight of 271.49 g/mol. Its IUPAC name is N-[(Z)-5-amino-2-methylhex-4-en-3-ylidene]-N'-methylethanimidamide;ethane.
Molecular Properties
| Compound Name | N-[(Z)-5-amino-2-methylhex-4-en-3-ylidene]-N'-methylethanimidamide;ethane |
| PubChem CID | 172597690 |
| Molecular Formula | C16H37N3 |
| Molecular Weight | 271.49 g/mol |
| Exact Mass | 271.30 |
| IUPAC Name | N-[(Z)-5-amino-2-methylhex-4-en-3-ylidene]-N'-methylethanimidamide;ethane |
| SMILES | C/N=C(C)/N=C(/C=C(/C)N)C(C)C.CC.CC.CC |
| InChI | InChI=1S/C10H19N3.3C2H6/c1-7(2)10(6-8(3)11)13-9(4)12-5;3*1-2/h6-7H,11H2,1-5H3;3*1-2H3/b8-6-,12-9+,13-10-;;; |
| InChIKey | QSNBVOCFOCAMHD-BBYFLTQBSA-N |
| XLogP | 5.07 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 271.49 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-[(Z)-5-amino-2-methylhex-4-en-3-ylidene]-N'-methylethanimidamide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(Z)-5-amino-2-methylhex-4-en-3-ylidene]-N'-methylethanimidamide;ethane?
The IUPAC name of N-[(Z)-5-amino-2-methylhex-4-en-3-ylidene]-N'-methylethanimidamide;ethane (CID 172597690) is N-[(Z)-5-amino-2-methylhex-4-en-3-ylidene]-N'-methylethanimidamide;ethane.
What is the SMILES notation for N-[(Z)-5-amino-2-methylhex-4-en-3-ylidene]-N'-methylethanimidamide;ethane?
The canonical SMILES for N-[(Z)-5-amino-2-methylhex-4-en-3-ylidene]-N'-methylethanimidamide;ethane is C/N=C(C)/N=C(/C=C(/C)N)C(C)C.CC.CC.CC.
What is the InChIKey of N-[(Z)-5-amino-2-methylhex-4-en-3-ylidene]-N'-methylethanimidamide;ethane?
The InChIKey is QSNBVOCFOCAMHD-BBYFLTQBSA-N. The full InChI is InChI=1S/C10H19N3.3C2H6/c1-7(2)10(6-8(3)11)13-9(4)12-5;3*1-2/h6-7H,11H2,1-5H3;3*1-2H3/b8-6-,12-9+,13-10-;;;.
What are the key properties of N-[(Z)-5-amino-2-methylhex-4-en-3-ylidene]-N'-methylethanimidamide;ethane?
N-[(Z)-5-amino-2-methylhex-4-en-3-ylidene]-N'-methylethanimidamide;ethane has a molecular weight of 271.49 g/mol, XLogP of 5.07, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(Z)-5-amino-2-methylhex-4-en-3-ylidene]-N'-methylethanimidamide;ethane is sourced from PubChem (CID 172597690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).