C9H14N2 — CID 45079075
1-ethyl-4,6-dimethylpyridin-2-imine (PubChem CID 45079075) has the molecular formula C9H14N2 and a molecular weight of 150.22 g/mol. Its IUPAC name is 1-ethyl-4,6-dimethylpyridin-2-imine.
| Compound Name | 1-ethyl-4,6-dimethylpyridin-2-imine |
|---|---|
| PubChem CID | 45079075 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | 1-ethyl-4,6-dimethylpyridin-2-imine |
| SMILES | [H]/N=c1\cc(C)cc(C)n1CC |
| InChI | InChI=1S/C9H14N2/c1-4-11-8(3)5-7(2)6-9(11)10/h5-6,10H,4H2,1-3H3/b10-9+ |
| InChIKey | UMMWJLQPXMTYKV-MDZDMXLPSA-N |
| XLogP | 1.60 |
| TPSA | 28.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |