C7H10N2 — CID 70512128
1,5-dimethylpyridin-2-imine (PubChem CID 70512128) has the molecular formula C7H10N2 and a molecular weight of 122.17 g/mol. Its IUPAC name is 1,5-dimethylpyridin-2-imine.
| Compound Name | 1,5-dimethylpyridin-2-imine |
|---|---|
| PubChem CID | 70512128 |
| Molecular Formula | C7H10N2 |
| Molecular Weight | 122.17 g/mol |
| Exact Mass | 122.08 |
| IUPAC Name | 1,5-dimethylpyridin-2-imine |
| SMILES | [H]/N=c1\ccc(C)cn1C |
| InChI | InChI=1S/C7H10N2/c1-6-3-4-7(8)9(2)5-6/h3-5,8H,1-2H3/b8-7+ |
| InChIKey | KCRGVZGZRAZYCZ-BQYQJAHWSA-N |
| XLogP | 0.81 |
| TPSA | 28.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 122.17 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |